| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:49 UTC |
|---|
| Update Date | 2025-03-21 18:33:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097633 |
|---|
| Frequency | 28.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O2 |
|---|
| Molecular Mass | 206.1307 |
|---|
| SMILES | Cc1ccc(C)c(CC(=O)C(C)O)c1C |
|---|
| InChI Key | BTNCLCFNJPWYEF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketoneshydrocarbon derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupalpha-hydroxy ketoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|