| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:52 UTC |
|---|
| Update Date | 2025-03-21 18:33:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097738 |
|---|
| Frequency | 28.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N4O2S |
|---|
| Molecular Mass | 212.0368 |
|---|
| SMILES | Cn1c(=O)n(C)c2c(=O)[nH]c(=S)[nH]c21 |
|---|
| InChI Key | NEWZKZPCGMGYJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | xanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-thiopyrimidinesalkaloids and derivativesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspurinonespyrimidinethionespyrimidonesthioureasthioxanthinesureasvinylogous amides |
|---|
| Substituents | thiourealactampyrimidinethionepyrimidoneorganosulfur compoundpurinonepyrimidineureaorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compound2-thiopyrimidineazolen-substituted imidazolevinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundxanthinethioxanthinealkaloid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundthiopyrimidine |
|---|
