| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:52 UTC |
|---|
| Update Date | 2025-03-21 18:33:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097743 |
|---|
| Frequency | 28.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N4O3PS+ |
|---|
| Molecular Mass | 315.0675 |
|---|
| SMILES | Cc1ncc(C[n+]2csc(CP(=O)(O)O)c2C)c(N)n1 |
|---|
| InChI Key | MRLIBULPEJSPDQ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | thiazoles |
|---|
| Direct Parent | 4,5-disubstituted thiazoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic cationsorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | aromatic heteromonocyclic compoundazacycleheteroaromatic compound4,5-disubstituted 1,3-thiazolepyrimidineorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic cationimidolactamamineorganophosphonic acid derivative |
|---|
