| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:53 UTC |
|---|
| Update Date | 2025-03-21 18:33:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097811 |
|---|
| Frequency | 28.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H34Cl2N4O5 |
|---|
| Molecular Mass | 576.1906 |
|---|
| SMILES | OCCOCCN1CCN(c2ccc(OCC3COC(Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
|---|
| InChI Key | MTEIXIQRYWIRFD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesalcohols and polyolsalkyl aryl ethersaminophenyl ethersaniline and substituted anilinesaryl chloridesazacyclic compoundsdialkyl ethersdialkylarylaminesdichlorobenzenesheteroaromatic compoundshydrocarbon derivativesimidazolesketalsn-alkylpiperazinesn-arylpiperazinesn-substituted imidazolesorganochloridesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundstrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietymeta-dioxolaneetheraromatic heteromonocyclic compoundorganochloridealkyl aryl etherorganohalogen compounddialkyl ether1,3-dichlorobenzeneacetalimidazoleketaltertiary aliphatic/aromatic amineorganonitrogen compoundorganopnictogen compounddialkylarylamineaminophenyl ethertertiary amineazolen-substituted imidazolearyl chloridechlorobenzenealcoholazacycleaniline or substituted anilinesn-alkylpiperazineheteroaromatic compoundtertiary aliphatic aminearyl halidephenylpiperazineoxacycleorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
