| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:55 UTC |
|---|
| Update Date | 2025-03-21 18:33:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097860 |
|---|
| Frequency | 28.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H21O11+ |
|---|
| Molecular Mass | 449.1078 |
|---|
| SMILES | OCC1OC(Oc2cc3c(O)cc(O)cc3[o+]c2-c2cc(O)cc(O)c2)C(O)C(O)C1O |
|---|
| InChI Key | QMTNGNGZFXBVPX-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | anthocyanidin-3-o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsacetalsanthocyanidinsbenzene and substituted derivativesflavonoid-3-o-glycosidesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic cationsoxacyclic compoundsoxanesprimary alcoholsresorcinolssecondary alcohols |
|---|
| Substituents | monocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharideanthocyanidin-3-o-glycosideresorcinolsaccharideacetalaromatic heteropolycyclic compoundflavonoid-3-o-glycosideanthocyanidinorganic cationoxaneprimary alcoholorganoheterocyclic compoundalcoholbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound7-hydroxyflavonoidsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|