| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:14:55 UTC |
|---|
| Update Date | 2025-03-21 18:33:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00097886 |
|---|
| Frequency | 28.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N2O6 |
|---|
| Molecular Mass | 284.1008 |
|---|
| SMILES | O=C(NC1C(O)OC(CO)C(O)C1O)c1ccccn1 |
|---|
| InChI Key | NBXFSLBRHSLQOR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridines2-heteroaryl carboxamidesazacyclic compoundscarboxylic acids and derivativeshemiacetalsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspyridinecarboxylic acids and derivativessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivative2-heteroaryl carboxamiden-acyl-alpha-hexosamineorganic oxideorganonitrogen compoundorganopnictogen compoundhemiacetal2-halopyridineoxaneprimary alcoholorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundhydroxypyridinecarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidepyridinesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
