Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-21 00:14:58 UTC |
---|
Update Date | 2025-03-21 18:33:53 UTC |
---|
HMDB ID | HMDB0130513 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00098003 |
---|
Name | 3-(4-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-7,8-diol |
---|
Frequency | 28.1 |
---|
Structure | |
---|
Chemical Formula | C15H14O4 |
---|
Molecular Mass | 258.0892 |
---|
SMILES | Oc1ccc(C2COc3c(ccc(O)c3O)C2)cc1 |
---|
InChI Key | JYTKPSXFNOBXQJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflavans |
---|
Direct Parent | isoflavanols |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compounds |
---|
Substituents | monocyclic benzene moietyetherbenzopyran1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundchromanephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|