| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:01 UTC |
|---|
| Update Date | 2025-03-21 18:33:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098116 |
|---|
| Frequency | 28.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N2O6P |
|---|
| Molecular Mass | 290.0668 |
|---|
| SMILES | CC(=O)NCc1c(COP(=O)(O)O)cnc(C)c1O |
|---|
| InChI Key | GHPKNHZUTAMQEY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridoxamines |
|---|
| Direct Parent | pyridoxamine 5'-phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesacetamidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesmonoalkyl phosphatesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundpolyhalopyridinecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compound2-halopyridineacetamideazacycleheteroaromatic compoundhydroxypyridinemethylpyridinecarboxamide grouppyridoxamine 5'-phosphatesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
