| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:15:03 UTC |
|---|
| Update Date | 2025-03-21 18:33:54 UTC |
|---|
| HMDB ID | HMDB0249079 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098222 |
|---|
| Name | Benzylidene thiazolidinedione |
|---|
| Frequency | 28.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H7NO2S |
|---|
| Molecular Mass | 205.0197 |
|---|
| SMILES | O=C1NC(=O)C(=Cc2ccccc2)S1 |
|---|
| InChI Key | SGIZECXZFLAGBW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | thiazolidines |
|---|
| Direct Parent | thiazolidinediones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsthiazolidinesthiolactones |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarbonic acid derivativearomatic heteromonocyclic compoundazacyclecarboxylic acid derivativethiazolidinedioneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoiddicarboximideorganic nitrogen compoundthiolactoneorganooxygen compound |
|---|
