| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:04 UTC |
|---|
| Update Date | 2025-03-21 18:33:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098261 |
|---|
| Frequency | 28.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N2O4S |
|---|
| Molecular Mass | 246.0674 |
|---|
| SMILES | O=C(O)CCC(O)C1SCC2NC(=O)NC21 |
|---|
| InChI Key | LCIOIPLHCNBLNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thienoimidazolidines |
|---|
| Subclass | thienoimidazolidines |
|---|
| Direct Parent | thienoimidazolidines |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsimidazolidinonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholsshort-chain hydroxy acids and derivativesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinefatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidfatty acidthiophenecarboxylic acid derivativealiphatic heteropolycyclic compoundimidazolidinoneorganic oxideorganonitrogen compoundorganopnictogen compoundhydroxy fatty acidalcoholcarbonic acid derivativeazacycledialkylthioetherthienoimidazolidinemonocarboxylic acid or derivativesorganic oxygen compoundthioethersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|