| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:08 UTC |
|---|
| Update Date | 2025-03-21 18:33:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098402 |
|---|
| Frequency | 28.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12Cl3NO2 |
|---|
| Molecular Mass | 294.9934 |
|---|
| SMILES | CN(C)C(=O)OC(c1ccccc1)C(Cl)(Cl)Cl |
|---|
| InChI Key | KBAQAKNWEYZPDV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl chloridescarbamate esterscarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | benzyloxycarbonylcarbonyl groupcarbonic acid derivativealkyl chlorideorganochloridecarbamic acid esterorganohalogen compoundaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
