| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:09 UTC |
|---|
| Update Date | 2025-03-21 18:33:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098427 |
|---|
| Frequency | 28.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H8NO8P |
|---|
| Molecular Mass | 240.9988 |
|---|
| SMILES | O=C1NC(=O)C(C(O)COP(=O)(O)O)O1 |
|---|
| InChI Key | FVCWSOSBVJYNAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | oxazolidines |
|---|
| Direct Parent | oxazolidinediones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbamate esterscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acid derivativeoxazolidinedioneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximidealcoholcarbonic acid derivativeazacyclecarbamic acid esteroxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
