| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:09 UTC |
|---|
| Update Date | 2025-03-21 18:33:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098448 |
|---|
| Frequency | 27.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H8NO5+ |
|---|
| Molecular Mass | 162.0397 |
|---|
| SMILES | C[N+](=O)C(CC(=O)O)C(=O)O |
|---|
| InChI Key | UTCWIJSBFMWQKX-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaminoxidescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesfatty acids and conjugateshydrocarbon derivativesorganic cationsorganic oxidesorganic oxoazanium compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidfatty acidorganic oxideorganic oxygen compoundaminoxideaspartic acid or derivativesorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic oxoazaniumorganooxygen compound |
|---|
