Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:15:09 UTC |
---|
Update Date | 2025-03-21 18:33:57 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00098449 |
---|
Frequency | 27.9 |
---|
Structure | |
---|
Chemical Formula | C14H13NO6S |
---|
Molecular Mass | 323.0464 |
---|
SMILES | NC(=O)Cc1ccc(Oc2ccccc2OS(=O)(=O)O)cc1 |
---|
InChI Key | AYEMZDQPHHEBLM-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | diphenylethers |
---|
Direct Parent | diphenylethers |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | carbonyl compoundscarboxylic acids and derivativesdiarylethershydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylacetamidesphenylsulfatesprimary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | primary carboxylic acid amidediaryl etherphenol ethersulfuric acid monoestercarbonyl groupethercarboxylic acid derivativephenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundarylsulfatephenylacetamideorganic sulfuric acid or derivativescarboxamide grouparomatic homomonocyclic compoundorganic oxygen compoundsulfate-esterhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundsulfuric acid esterdiphenyletherorganooxygen compound |
---|