| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:13 UTC |
|---|
| Update Date | 2025-03-21 18:33:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098604 |
|---|
| Frequency | 27.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O6 |
|---|
| Molecular Mass | 200.0321 |
|---|
| SMILES | COc1c(O)cc(C(=O)O)c(O)c1O |
|---|
| InChI Key | OOIASTKFVJMPSC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | quinone and hydroquinone lipids |
|---|
| Direct Parent | ubiquinols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesp-methoxybenzoic acids and derivativesphenoxy compoundssalicylic acidsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyethercarboxylic acidmethoxyphenolbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidalkyl aryl ethercarboxylic acid derivativeorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidbenzoic acid or derivativesubiquinol skeleton1-hydroxy-4-unsubstituted benzenoidmethoxybenzenehydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesp-methoxybenzoic acid or derivativesanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
