| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:19 UTC |
|---|
| Update Date | 2025-03-21 18:34:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098830 |
|---|
| Frequency | 27.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H16O7 |
|---|
| Molecular Mass | 356.0896 |
|---|
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)C2COC(c3ccc(O)c(O)c3)C12 |
|---|
| InChI Key | BGZTZKWSCRATJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | lignan lactones |
|---|
| Direct Parent | lignan lactones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativesbenzodioxolescarbonyl compoundscarboxylic acid estersdialkyl ethersfuran lignansfurofuran lignansfurofuransgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupetherfurofuran lignan skeleton1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativedialkyl etherlignan lactonelactoneorganic oxideacetalaromatic heteropolycyclic compoundfurofuranorganoheterocyclic compoundbenzodioxoletetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclefuran lignan skeletonmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterfuranoid lignanphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|