| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:15:20 UTC |
|---|
| Update Date | 2025-03-21 18:34:03 UTC |
|---|
| HMDB ID | HMDB0240378 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098868 |
|---|
| Name | HBOA glucuronide |
|---|
| Frequency | 27.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H15NO9 |
|---|
| Molecular Mass | 341.0747 |
|---|
| SMILES | O=C(O)C1OC(OC2Oc3ccccc3N=C2O)C(O)C(O)C1O |
|---|
| InChI Key | PXAGSWBDUVOULJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsazacyclic compoundsbenzenoidsbenzoxazinesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclic carboximidic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanespropargyl-type 1,3-dipolar organic compoundspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidpropargyl-type 1,3-dipolar organic compound1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesazacyclebenzoxazineorganic 1,3-dipolar compoundhydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundcyclic carboximidic acid |
|---|
