| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:22 UTC |
|---|
| Update Date | 2025-03-21 18:34:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00098945 |
|---|
| Frequency | 27.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C40H80N2O5P+ |
|---|
| Molecular Mass | 699.5799 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)NC(CO[PH](=O)OCC[N+](C)(C)C)C(O)CCCCCCCC=CCCCCCCC |
|---|
| InChI Key | BWZXXTYFXHFLSO-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | phosphonic acid diesters |
|---|
| Direct Parent | phosphonic acid diesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphate esterssecondary alcoholssecondary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupfatty amidecarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic saltalcoholtetraalkylammonium saltquaternary ammonium saltphosphonic acid diestercarboxamide groupn-acyl-aminesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
