Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:15:22 UTC |
---|
Update Date | 2025-03-21 18:34:03 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00098962 |
---|
Frequency | 27.8 |
---|
Structure | |
---|
Chemical Formula | C11H17N3O7P+ |
---|
Molecular Mass | 334.0799 |
---|
SMILES | NC(=O)c1ccc[n+](C2OC(COP(N)(=O)O)C(O)C2O)c1 |
---|
InChI Key | FXUWBZITYLBCTL-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | pyridines and derivatives |
---|
Subclass | pyridinecarboxylic acids and derivatives |
---|
Direct Parent | pyridinecarboxylic acids and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,2-diolsazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonosaccharidesnicotinamidesorganic cationsorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphosphate estersphosphoric monoester monoamidesprimary carboxylic acid amidessecondary alcoholstetrahydrofuransvinylogous amides |
---|
Substituents | primary carboxylic acid amidepyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundnicotinamidemonosaccharidecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic phosphoric acid amide1,2-diolalcoholphosphoric monoester monoamidevinylogous amideazacycletetrahydrofuranheteroaromatic compoundhydroxypyridinecarboxamide groupoxacycleorganic oxygen compoundphosphoric acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
---|