| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:26 UTC |
|---|
| Update Date | 2025-03-21 18:34:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00099132 |
|---|
| Frequency | 27.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6Cl2N2O3S |
|---|
| Molecular Mass | 267.9476 |
|---|
| SMILES | NC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Cl |
|---|
| InChI Key | IPRGYSAYIGOGMN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 2-halobenzoic acids and derivatives4-halobenzoic acids and derivativesaminosulfonyl compoundsaryl chloridesbenzamidesbenzenesulfonyl compoundsbenzoyl derivativescarboxylic acids and derivativesdichlorobenzeneshydrocarbon derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesprimary carboxylic acid amidesvinylogous halides |
|---|
| Substituents | primary carboxylic acid amideorganosulfonic acid or derivativesorganochloridebenzoylorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundbenzamide1,3-dichlorobenzeneorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl grouparyl chloridechlorobenzenebenzenesulfonamideaminosulfonyl compoundbenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide groupvinylogous halide2-halobenzoic acid or derivativesaryl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundsulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
