| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:26 UTC |
|---|
| Update Date | 2025-03-21 18:34:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00099139 |
|---|
| Frequency | 27.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H9FO2 |
|---|
| Molecular Mass | 216.0587 |
|---|
| SMILES | O=C(O)c1cccc(-c2ccc(F)cc2)c1 |
|---|
| InChI Key | YUQPLNXKGVRIAJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl fluoridesbenzoyl derivativescarboxylic acidsfluorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganooxygen compounds |
|---|
| Substituents | aryl fluoridecarboxylic acidorganofluoridebenzoylcarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compoundfluorobenzeneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativehalobenzenebenzoic acidorganooxygen compound |
|---|