Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:15:29 UTC |
---|
Update Date | 2025-03-21 18:34:07 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00099251 |
---|
Frequency | 27.7 |
---|
Structure | |
---|
Chemical Formula | C14H20N2O3 |
---|
Molecular Mass | 264.1474 |
---|
SMILES | COC(=O)C(Cc1ccccc1)NC(=O)CCCN |
---|
InChI Key | YMPFARPYFOGNQV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | phenylalanine and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acid estersalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundsfatty acid estersgamma amino acids and derivativeshydrocarbon derivativesmethyl estersmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
---|
Substituents | fatty acylmonocyclic benzene moietycarbonyl groupgamma amino acid or derivativesfatty amideorganic oxidemethyl esterorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesalpha-amino acid estern-acyl-alpha-amino acidcarboxamide groupn-acyl-aminearomatic homomonocyclic compoundsecondary carboxylic acid amidefatty acid estermonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|