| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:36 UTC |
|---|
| Update Date | 2025-03-21 18:34:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00099500 |
|---|
| Frequency | 27.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H11O12P3 |
|---|
| Molecular Mass | 343.9463 |
|---|
| SMILES | O=P(O)(O)OCC1OP(=O)(OP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | XGEFVYLMVUVLGJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxaphospholanesphosphacyclic compoundsphosphonic acid esterssecondary alcohols |
|---|
| Substituents | alcoholphosphacyclephosphonic acid esteroxacycle1,2_oxaphospholaneorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganophosphonic acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
