Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-21 00:15:37 UTC |
---|
Update Date | 2025-03-21 18:34:10 UTC |
---|
HMDB ID | HMDB0256480 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00099545 |
---|
Name | Phosphohistidine |
---|
Frequency | 41.7 |
---|
Structure | |
---|
Chemical Formula | C6H10N3O5P |
---|
Molecular Mass | 235.0358 |
---|
SMILES | O=C(O)C(Cc1c[nH]cn1)NP(=O)(O)O |
---|
InChI Key | FDIKHVQUPVCJFA-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | alpha amino acids |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compounds |
---|
Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundazacycleheteroaromatic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundimidazoleorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganic phosphoric acid amideorganoheterocyclic compoundorganooxygen compoundazole |
---|