| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:38 UTC |
|---|
| Update Date | 2025-03-21 18:34:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00099593 |
|---|
| Frequency | 27.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H13N5O5 |
|---|
| Molecular Mass | 295.0917 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C2OOC2C1O |
|---|
| InChI Key | GGJIRIAJZDTYLQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl peroxidesdioxetanesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholsprimary aminespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | monosaccharidepyrimidinesaccharidearomatic heteropolycyclic compoundimidazoledialkyl peroxideorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholimidolactamazolen-substituted imidazole1,2-dioxetanealcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
