Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-21 00:15:40 UTC |
---|
Update Date | 2025-03-21 18:34:11 UTC |
---|
HMDB ID | HMDB0134939 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00099651 |
---|
Name | 2-{[hydroxy(5-hydroxy-1H-indol-3-yl)methylidene]amino}acetic acid |
---|
Frequency | 27.5 |
---|
Structure | |
---|
Chemical Formula | C11H10N2O4 |
---|
Molecular Mass | 234.0641 |
---|
SMILES | O=C(O)CNC(=O)c1c[nH]c2ccc(O)cc12 |
---|
InChI Key | QHAVMYGKSRARTE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | acyl glycines |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acidsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesindolecarboxamides and derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrole carboxamidessecondary carboxylic acid amidesvinylogous amides |
---|
Substituents | carbonyl groupindolecarboxamide derivativecarboxylic acidpyrrole-3-carboxylic acid or derivativesindole1-hydroxy-2-unsubstituted benzenoidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyrrole-3-carboxamidealpha-amino acidorganopnictogen compoundorganoheterocyclic compoundindolecarboxylic acid derivativevinylogous amideazacycleheteroaromatic compoundindole or derivativescarboxamide groupn-acylglycinesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|