| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:46 UTC |
|---|
| Update Date | 2025-03-21 18:34:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00099905 |
|---|
| Frequency | 27.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6O6S |
|---|
| Molecular Mass | 205.9885 |
|---|
| SMILES | Cc1cc(=O)c(OS(=O)(=O)O)co1 |
|---|
| InChI Key | FFPYVJUOXHKQFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | cyclic ketonesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesteraromatic heteromonocyclic compoundheteroaromatic compoundcyclic ketoneoxacycleorganic oxideorganic oxygen compoundpyranpyranonesulfate-esterhydrocarbon derivativearylsulfatesulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
