| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:46 UTC |
|---|
| Update Date | 2025-03-21 18:34:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00099930 |
|---|
| Frequency | 27.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H5O8P |
|---|
| Molecular Mass | 199.9722 |
|---|
| SMILES | O=C(O)C(=O)C(O)OP(=O)(O)O |
|---|
| InChI Key | OGIYJXRPEDJJSV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | glycerone phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesbeta hydroxy acids and derivativescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxides |
|---|
| Substituents | aliphatic acyclic compoundcarboxylic acidmonosaccharidehydroxy acidalpha-hydroxy ketonecarboxylic acid derivativeglycerone phosphatebeta-hydroxy acidsaccharideorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphateketo acidalpha-keto acidhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
