| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:47 UTC |
|---|
| Update Date | 2025-03-21 18:34:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00099953 |
|---|
| Frequency | 27.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N3O6S |
|---|
| Molecular Mass | 307.0838 |
|---|
| SMILES | CSCCC(NC(=N)NC(CC(=O)O)C(=O)O)C(=O)O |
|---|
| InChI Key | FMFLSDKXZKSFTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | methionine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaspartic acid and derivativescarbonyl compoundscarboximidamidescarboxylic acidsdialkylthioethersfatty acylsguanidineshydrocarbon derivativesiminesorganic oxidesorganopnictogen compoundssulfenyl compoundsthia fatty acidstricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidguanidineiminetricarboxylic acid or derivativesorganosulfur compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundsulfenyl compounddialkylthioethercarboximidamidethia fatty acidorganic oxygen compoundthioethermethionine or derivativesaspartic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|