| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:50 UTC |
|---|
| Update Date | 2025-03-21 18:34:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100106 |
|---|
| Frequency | 27.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15NO5 |
|---|
| Molecular Mass | 301.095 |
|---|
| SMILES | O=C(O)CCC(NC(=O)c1ccc2ccccc2c1)C(=O)O |
|---|
| InChI Key | YKNDIAJZDLLIDP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsnaphthalenecarboxamidesnaphthalenecarboxylic acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesn-acyl-alpha-amino acidaromatic homopolycyclic compoundglutamic acid or derivativescarboxamide group2-naphthalenecarboxamidesecondary carboxylic acid amidenaphthaleneorganic oxygen compound2-naphthalenecarboxylic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compound2-naphthalenecarboxylic acidorganooxygen compound |
|---|
