| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:53 UTC |
|---|
| Update Date | 2025-03-21 18:34:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100217 |
|---|
| Frequency | 27.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9N5O2 |
|---|
| Molecular Mass | 219.0756 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1C=CC(O)O1 |
|---|
| InChI Key | FMHPIJQHUOZJHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdihydrofuranshemiacetalsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | azacycleheteroaromatic compoundpyrimidineoxacycleorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhemiacetalhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundimidolactamamineorganooxygen compoundazolen-substituted imidazoledihydrofuran |
|---|
