| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:53 UTC |
|---|
| Update Date | 2025-03-21 18:34:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100228 |
|---|
| Frequency | 27.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8O5 |
|---|
| Molecular Mass | 244.0372 |
|---|
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2occ(O)c12 |
|---|
| InChI Key | OFXKFDHXIZQAEU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furopyrans |
|---|
| Subclass | furopyrans |
|---|
| Direct Parent | furopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativesfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | furanmonocyclic benzene moietyheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidfuropyranoxacyclevinylogous acidorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
