| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:15:55 UTC |
|---|
| Update Date | 2025-03-21 18:34:20 UTC |
|---|
| HMDB ID | HMDB0246378 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100295 |
|---|
| Name | Felbinac |
|---|
| Frequency | 27.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O2 |
|---|
| Molecular Mass | 212.0837 |
|---|
| SMILES | O=C(O)Cc1ccc(-c2ccccc2)cc1 |
|---|
| InChI Key | QRZAKQDHEVVFRX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietycarbonyl grouporganic oxidemonocarboxylic acid or derivativescarboxylic acidorganic oxygen compoundhydrocarbon derivativecarboxylic acid derivativeorganooxygen compound |
|---|
