| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:56 UTC |
|---|
| Update Date | 2025-03-21 18:34:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100322 |
|---|
| Frequency | 27.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20N2O |
|---|
| Molecular Mass | 256.1576 |
|---|
| SMILES | CN(C)CCC(c1ccc(O)cc1)c1ccccn1 |
|---|
| InChI Key | URTFRBXIOATVPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pheniramines |
|---|
| Direct Parent | pheniramines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridinesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesorganooxygen compoundsorganopnictogen compoundstrialkylamines |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundpheniramineazacycleheteroaromatic compoundtertiary aliphatic aminehydroxypyridine1-hydroxy-2-unsubstituted benzenoidmethylpyridineorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
