| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:15:57 UTC |
|---|
| Update Date | 2025-03-21 18:34:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100364 |
|---|
| Frequency | 27.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H19FO2 |
|---|
| Molecular Mass | 286.1369 |
|---|
| SMILES | CC(C(=O)O)c1cccc(C(C)(C)c2ccc(F)cc2)c1 |
|---|
| InChI Key | OAIIMCMVZLOFFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl fluoridescarbonyl compoundscarboxylic acidsfluorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesphenylpropanesphenylpropanoic acids |
|---|
| Substituents | aryl fluoridediphenylmethanecarbonyl groupcarboxylic acidorganofluoridecarboxylic acid derivativeorganohalogen compoundaryl halidephenylpropanearomatic homomonocyclic compoundfluorobenzeneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidhydrocarbon derivativehalobenzeneorganooxygen compound |
|---|
