| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:06 UTC |
|---|
| Update Date | 2025-03-21 18:34:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100725 |
|---|
| Frequency | 27.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6N4O4S |
|---|
| Molecular Mass | 254.011 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)SCC(C(=O)C(=O)O)=N2 |
|---|
| InChI Key | YCUZJCDXPFMFJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organosulfur compounds |
|---|
| Class | thioethers |
|---|
| Subclass | aryl thioethers |
|---|
| Direct Parent | aryl thioethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-thiazinesalkylarylthioethersalpha-keto acids and derivativesamino acidsazacyclic compoundscarboxylic acidsfatty acylsheteroaromatic compoundshydrocarbon derivativesketiminesketonesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonesthia fatty acidsvinylogous amidesvinylogous thioesters |
|---|
| Substituents | fatty acylketiminecarbonyl groupcarboxylic acidamino acid or derivativesamino acidiminepyrimidonealkylarylthioethercarboxylic acid derivativearyl thioetherpyrimidinepropargyl-type 1,3-dipolar organic compoundketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-keto acidorganopnictogen compoundorganoheterocyclic compoundvinylogous amidevinylogous thioesterpara-thiazineazacycleheteroaromatic compoundorganic 1,3-dipolar compoundmonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundketo acidhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|