| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:07 UTC |
|---|
| Update Date | 2025-03-21 18:34:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100765 |
|---|
| Frequency | 27.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C25H31NO9 |
|---|
| Molecular Mass | 489.1999 |
|---|
| SMILES | COC(=O)C1OC(OC2C=CC3C4Cc5ccc(OC)c6c5C3(CCN4C)C2O6)C(O)C(O)C1O |
|---|
| InChI Key | CZLXNWHMDWXCAW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalsalkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscoumaransglucuronic acid derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenanthrenes and derivativespiperidinespyran carboxylic acidssecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol ethercarbonyl groupetherglucuronic acid or derivativesamino acid or derivativeso-glucuronidemonosaccharidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxidemethyl esteracetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundoxanepiperidinetertiary amineorganoheterocyclic compoundcoumaranalcoholphenanthrenepyran carboxylic acid or derivativesazacycletertiary aliphatic aminehydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyrananisolecarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
|---|
