Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 00:16:11 UTC |
---|
Update Date | 2025-03-21 18:34:28 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00100941 |
---|
Frequency | 27.1 |
---|
Structure | |
---|
Chemical Formula | C9H9NO5S |
---|
Molecular Mass | 243.0201 |
---|
SMILES | O=C1CC(OS(=O)(=O)O)c2ccccc2N1 |
---|
InChI Key | XMHWTYHEENMMMP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | quinolines and derivatives |
---|
Subclass | quinolones and derivatives |
---|
Direct Parent | hydroquinolones |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | alkyl sulfatesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativeshydroquinolineslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl grouplactamcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundalkyl sulfateorganonitrogen compoundorganopnictogen compoundtetrahydroquinolinetetrahydroquinoloneorganic sulfuric acid or derivativesazacyclecarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|