| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:12 UTC |
|---|
| Update Date | 2025-03-21 18:34:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00100993 |
|---|
| Frequency | 27.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H24O10 |
|---|
| Molecular Mass | 436.1369 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)c1c(O)cc(O)cc1OC1C(O)C(O)C(O)C(O)C1O |
|---|
| InChI Key | MCSYOZXIFXHXMQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolscyclitols and derivativescyclohexanolshydrocarbon derivativesorganic oxidesphenol ethersphenoxy compoundsresorcinolsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether2'-hydroxy-dihydrochalconearyl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolalkyl aryl etherresorcinolketoneorganic oxidealcoholcyclohexanolcyclitol or derivatives1-hydroxy-4-unsubstituted benzenoidcyclic alcoholphenylketonebutyrophenonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
