| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:12 UTC |
|---|
| Update Date | 2025-03-21 18:34:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101000 |
|---|
| Frequency | 27.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15N7O6 |
|---|
| Molecular Mass | 365.1084 |
|---|
| SMILES | Nc1ncc2c(n1)nc1c(=O)[nH]c(=O)nc-1n2CC(O)C(O)C(O)CO |
|---|
| InChI Key | FRAVVMSSFLDWTI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary alcoholsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | alcoholcarbonic acid derivativelactamazacycleheteroaromatic compoundpyrimidonepteridinepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundprimary alcoholamineorganooxygen compound |
|---|
