| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:19 UTC |
|---|
| Update Date | 2025-03-21 18:34:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101297 |
|---|
| Frequency | 43.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO9 |
|---|
| Molecular Mass | 309.106 |
|---|
| SMILES | CC(O)=NC1C(O)OC(CO)C(O)C1OC(=O)C(O)CO |
|---|
| InChI Key | OGZYLGLJVCBMCU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboximidic acidscarboxylic acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholspropargyl-type 1,3-dipolar organic compoundssecondary alcoholssugar acids and derivatives |
|---|
| Substituents | carboximidic acidcarbonyl groupmonosaccharidecarboxylic acid derivativen-acyl-alpha-hexosaminepropargyl-type 1,3-dipolar organic compoundbeta-hydroxy acidorganic oxideglyceric_acidaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholorganic 1,3-dipolar compoundhydroxy acidacylaminosugaroxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|