| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:20 UTC |
|---|
| Update Date | 2025-03-21 18:34:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101332 |
|---|
| Frequency | 26.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O6 |
|---|
| Molecular Mass | 190.0477 |
|---|
| SMILES | O=C(O)C1CCCC(O)(C(=O)O)O1 |
|---|
| InChI Key | HVEFFGJSKIGLQI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesorganic oxidesoxacyclic compoundsoxanes |
|---|
| Substituents | carbonyl groupcarboxylic acidpyran carboxylic acid or derivativesalpha-hydroxy acidhydroxy acidcarboxylic acid derivativeoxacycleorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compounddicarboxylic acid or derivativeshemiacetalhydrocarbon derivativeoxaneorganooxygen compound |
|---|