| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:16:20 UTC |
|---|
| Update Date | 2025-03-21 18:34:33 UTC |
|---|
| HMDB ID | HMDB0253125 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101346 |
|---|
| Name | (4E,7E,10E,13E)-Hexadeca-4,7,10,13-tetraenoic acid |
|---|
| Frequency | 26.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24O2 |
|---|
| Molecular Mass | 248.1776 |
|---|
| SMILES | CCC=CCC=CCC=CCC=CCCC(=O)O |
|---|
| InChI Key | IVTCJQZAGWTMBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | long-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsfatty acylshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesstraight chain fatty acids |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupstraight chain fatty acidlong-chain fatty acidcarboxylic acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
