| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:22 UTC |
|---|
| Update Date | 2025-03-21 18:34:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101405 |
|---|
| Frequency | 26.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20NO+ |
|---|
| Molecular Mass | 206.1539 |
|---|
| SMILES | C[N+]1(C)CCCC1C(O)c1ccccc1 |
|---|
| InChI Key | KYFPETSTMNXZDH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaminesaromatic alcoholsazacyclic compoundshydrocarbon derivativesn-alkylpyrrolidinesorganic cationsorganic saltsorganopnictogen compoundssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietytetraalkylammonium saltaromatic heteromonocyclic compoundazacyclen-alkylpyrrolidine1,2-aminoalcoholquaternary ammonium saltorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltpyrrolidineamineorganoheterocyclic compoundorganooxygen compound |
|---|
