| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:27 UTC |
|---|
| Update Date | 2025-03-21 18:34:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101643 |
|---|
| Frequency | 26.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O7 |
|---|
| Molecular Mass | 286.1053 |
|---|
| SMILES | OC(O)C1OC(OCc2ccccc2)C(O)C(O)C1O |
|---|
| InChI Key | FWYAVKATWZWYFB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzene and substituted derivativescarbonyl hydrateshydrocarbon derivativesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl hydratearomatic heteromonocyclic compoundmonosaccharideoxacycleacetalsecondary alcoholhydrocarbon derivativebenzenoidoxaneorganoheterocyclic compound |
|---|
