| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:29 UTC |
|---|
| Update Date | 2025-03-21 18:34:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101686 |
|---|
| Frequency | 26.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17NO2S |
|---|
| Molecular Mass | 239.098 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)CCS(C)=O |
|---|
| InChI Key | FMRKKLBESVSWGM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidessulfinyl compoundssulfoxidesm-xylenes |
|---|
| Substituents | carbonyl groupm-xylenen-arylamideorganosulfur compoundcarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundxyleneanilidesecondary carboxylic acid amideorganic oxideorganic oxygen compoundsulfinyl compoundorganonitrogen compoundsulfoxideorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|