| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:29 UTC |
|---|
| Update Date | 2025-03-21 18:34:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101702 |
|---|
| Frequency | 34.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H5N5O5S |
|---|
| Molecular Mass | 259.0011 |
|---|
| SMILES | Nc1nc2nc(OS(=O)(=O)O)cnc2c(=O)[nH]1 |
|---|
| InChI Key | IOGFFWXJMOTKQA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | arylsulfatesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidonessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterlactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundarylsulfatepterinorganic sulfuric acid or derivativesazacycleheteroaromatic compoundorganic oxygen compoundpyrazinesulfate-esterhydrocarbon derivativeprimary amineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
|---|
