| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:16:29 UTC |
|---|
| Update Date | 2025-03-21 18:34:38 UTC |
|---|
| HMDB ID | HMDB0037340 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101720 |
|---|
| Name | Cosmosiin |
|---|
| Frequency | 26.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O10 |
|---|
| Molecular Mass | 432.1056 |
|---|
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(OC3OC(CO)C(O)C(O)C3O)cc(O)c12 |
|---|
| InChI Key | KMOUJOKENFFTPU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid-7-o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoidsacetalsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersprimary alcoholspyranones and derivativessecondary alcoholsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranoneoxaneprimary alcoholorganoheterocyclic compoundflavonoid-7-o-glycosidealcoholbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyransecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|