| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:31 UTC |
|---|
| Update Date | 2025-03-21 18:34:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101784 |
|---|
| Frequency | 32.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9FN6O |
|---|
| Molecular Mass | 272.0822 |
|---|
| SMILES | Nc1nc2nc(N)c(-c3ccc(F)cc3)nc2c(=O)[nH]1 |
|---|
| InChI Key | CQODHLZLLXZQKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl fluoridesazacyclic compoundsfluorobenzenesheteroaromatic compoundshydrocarbon derivativesimidolactamslactamsorganic oxidesorganofluoridesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietylactampyrimidoneorganohalogen compoundpyrimidinefluorobenzeneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactampterinazacycleorganofluorideheteroaromatic compoundaryl halideorganic oxygen compoundpyrazinehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
