| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:16:31 UTC |
|---|
| Update Date | 2025-03-21 18:34:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00101802 |
|---|
| Frequency | 26.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18N2O2 |
|---|
| Molecular Mass | 246.1368 |
|---|
| SMILES | CC(=O)c1ccc(N2CCN(C(C)=O)CC2)cc1 |
|---|
| InChI Key | AALVLJFUJNCVMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetophenonesamino acids and derivativesaniline and substituted anilinesaryl alkyl ketonesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenylpiperazinestertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonearomatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativeorganic oxidepiperazinetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundacetophenoneorganopnictogen compounddialkylarylaminetertiary amineorganoheterocyclic compoundacetamideazacycleaniline or substituted anilinescarboxamide groupphenylpiperazine1,4-diazinanehydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazinealkyl-phenylketone |
|---|
